C12H18F3IN4OS — CID 75532821
1-cyclopropyl-2-[(4-methyl-1,3-thiazol-2-yl)methyl]-3-(3,3,3-trifluoro-2-hydroxypropyl)guanidine;hydroiodide (PubChem CID 75532821) has the molecular formula C12H18F3IN4OS and a molecular weight of 450.27 g/mol. Its IUPAC name is 1-cyclopropyl-2-[(4-methyl-1,3-thiazol-2-yl)methyl]-3-(3,3,3-trifluoro-2-hydroxypropyl)guanidine;hydroiodide.
| Compound Name | 1-cyclopropyl-2-[(4-methyl-1,3-thiazol-2-yl)methyl]-3-(3,3,3-trifluoro-2-hydroxypropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 75532821 |
| Molecular Formula | C12H18F3IN4OS |
| Molecular Weight | 450.27 g/mol |
| Exact Mass | 450.02 |
| IUPAC Name | 1-cyclopropyl-2-[(4-methyl-1,3-thiazol-2-yl)methyl]-3-(3,3,3-trifluoro-2-hydroxypropyl)guanidine;hydroiodide |
| SMILES | Cc1csc(C/N=C(\NCC(O)C(F)(F)F)NC2CC2)n1.I |
| InChI | InChI=1S/C12H17F3N4OS.HI/c1-7-6-21-10(18-7)5-17-11(19-8-2-3-8)16-4-9(20)12(13,14)15;/h6,8-9,20H,2-5H2,1H3,(H2,16,17,19);1H |
| InChIKey | LWPLTOWYOZBYJO-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 69.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.27 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|