About N'-[3-(dimethylamino)-2,2-dimethylpropyl]-N-prop-2-enylmorpholine-4-carboximidamide
N'-[3-(dimethylamino)-2,2-dimethylpropyl]-N-prop-2-enylmorpholine-4-carboximidamide (PubChem CID 75532852) has the molecular formula C15H30N4O
and a molecular weight of 282.43 g/mol. Its IUPAC name is N'-[3-(dimethylamino)-2,2-dimethylpropyl]-N-prop-2-enylmorpholine-4-carboximidamide.
Molecular Properties
| Compound Name | N'-[3-(dimethylamino)-2,2-dimethylpropyl]-N-prop-2-enylmorpholine-4-carboximidamide |
| PubChem CID | 75532852 |
| Molecular Formula | C15H30N4O |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.24 |
| IUPAC Name | N'-[3-(dimethylamino)-2,2-dimethylpropyl]-N-prop-2-enylmorpholine-4-carboximidamide |
| SMILES | C=CCN/C(=N\CC(C)(C)CN(C)C)N1CCOCC1 |
| InChI | InChI=1S/C15H30N4O/c1-6-7-16-14(19-8-10-20-11-9-19)17-12-15(2,3)13-18(4)5/h6H,1,7-13H2,2-5H3,(H,16,17) |
| InChIKey | FIVVABKCNGFVEB-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 40.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N'-[3-(dimethylamino)-2,2-dimethylpropyl]-N-prop-2-enylmorpholine-4-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[3-(dimethylamino)-2,2-dimethylpropyl]-N-prop-2-enylmorpholine-4-carboximidamide?
The IUPAC name of N'-[3-(dimethylamino)-2,2-dimethylpropyl]-N-prop-2-enylmorpholine-4-carboximidamide (CID 75532852) is N'-[3-(dimethylamino)-2,2-dimethylpropyl]-N-prop-2-enylmorpholine-4-carboximidamide.
What is the SMILES notation for N'-[3-(dimethylamino)-2,2-dimethylpropyl]-N-prop-2-enylmorpholine-4-carboximidamide?
The canonical SMILES for N'-[3-(dimethylamino)-2,2-dimethylpropyl]-N-prop-2-enylmorpholine-4-carboximidamide is C=CCN/C(=N\CC(C)(C)CN(C)C)N1CCOCC1.
What is the InChIKey of N'-[3-(dimethylamino)-2,2-dimethylpropyl]-N-prop-2-enylmorpholine-4-carboximidamide?
The InChIKey is FIVVABKCNGFVEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H30N4O/c1-6-7-16-14(19-8-10-20-11-9-19)17-12-15(2,3)13-18(4)5/h6H,1,7-13H2,2-5H3,(H,16,17).
What are the key properties of N'-[3-(dimethylamino)-2,2-dimethylpropyl]-N-prop-2-enylmorpholine-4-carboximidamide?
N'-[3-(dimethylamino)-2,2-dimethylpropyl]-N-prop-2-enylmorpholine-4-carboximidamide has a molecular weight of 282.43 g/mol, XLogP of 1.04, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[3-(dimethylamino)-2,2-dimethylpropyl]-N-prop-2-enylmorpholine-4-carboximidamide is sourced from PubChem (CID 75532852), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).