About 2-[2-(dimethylamino)-3-ethylpentyl]-1,1-dimethylguanidine
2-[2-(dimethylamino)-3-ethylpentyl]-1,1-dimethylguanidine (PubChem CID 75532892) has the molecular formula C12H28N4
and a molecular weight of 228.38 g/mol. Its IUPAC name is 2-[2-(dimethylamino)-3-ethylpentyl]-1,1-dimethylguanidine.
Molecular Properties
| Compound Name | 2-[2-(dimethylamino)-3-ethylpentyl]-1,1-dimethylguanidine |
| PubChem CID | 75532892 |
| Molecular Formula | C12H28N4 |
| Molecular Weight | 228.38 g/mol |
| Exact Mass | 228.23 |
| IUPAC Name | 2-[2-(dimethylamino)-3-ethylpentyl]-1,1-dimethylguanidine |
| SMILES | CCC(CC)C(C/N=C(\N)N(C)C)N(C)C |
| InChI | InChI=1S/C12H28N4/c1-7-10(8-2)11(15(3)4)9-14-12(13)16(5)6/h10-11H,7-9H2,1-6H3,(H2,13,14) |
| InChIKey | WRPOPOWEKOGKOT-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 44.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.38 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(dimethylamino)-3-ethylpentyl]-1,1-dimethylguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(dimethylamino)-3-ethylpentyl]-1,1-dimethylguanidine?
The IUPAC name of 2-[2-(dimethylamino)-3-ethylpentyl]-1,1-dimethylguanidine (CID 75532892) is 2-[2-(dimethylamino)-3-ethylpentyl]-1,1-dimethylguanidine.
What is the SMILES notation for 2-[2-(dimethylamino)-3-ethylpentyl]-1,1-dimethylguanidine?
The canonical SMILES for 2-[2-(dimethylamino)-3-ethylpentyl]-1,1-dimethylguanidine is CCC(CC)C(C/N=C(\N)N(C)C)N(C)C.
What is the InChIKey of 2-[2-(dimethylamino)-3-ethylpentyl]-1,1-dimethylguanidine?
The InChIKey is WRPOPOWEKOGKOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H28N4/c1-7-10(8-2)11(15(3)4)9-14-12(13)16(5)6/h10-11H,7-9H2,1-6H3,(H2,13,14).
What are the key properties of 2-[2-(dimethylamino)-3-ethylpentyl]-1,1-dimethylguanidine?
2-[2-(dimethylamino)-3-ethylpentyl]-1,1-dimethylguanidine has a molecular weight of 228.38 g/mol, XLogP of 1.23, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(dimethylamino)-3-ethylpentyl]-1,1-dimethylguanidine is sourced from PubChem (CID 75532892), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).