About 1-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-2-propylguanidine;hydroiodide
1-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-2-propylguanidine;hydroiodide (PubChem CID 75532965) has the molecular formula C10H22F3IN4
and a molecular weight of 382.21 g/mol. Its IUPAC name is 1-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-2-propylguanidine;hydroiodide.
Molecular Properties
| Compound Name | 1-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-2-propylguanidine;hydroiodide |
| PubChem CID | 75532965 |
| Molecular Formula | C10H22F3IN4 |
| Molecular Weight | 382.21 g/mol |
| Exact Mass | 382.08 |
| IUPAC Name | 1-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-2-propylguanidine;hydroiodide |
| SMILES | CCC/N=C(\N)NCCCN(C)CC(F)(F)F.I |
| InChI | InChI=1S/C10H21F3N4.HI/c1-3-5-15-9(14)16-6-4-7-17(2)8-10(11,12)13;/h3-8H2,1-2H3,(H3,14,15,16);1H |
| InChIKey | DXGVMKMYIFNHEA-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.21 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-2-propylguanidine;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-2-propylguanidine;hydroiodide?
The IUPAC name of 1-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-2-propylguanidine;hydroiodide (CID 75532965) is 1-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-2-propylguanidine;hydroiodide.
What is the SMILES notation for 1-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-2-propylguanidine;hydroiodide?
The canonical SMILES for 1-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-2-propylguanidine;hydroiodide is CCC/N=C(\N)NCCCN(C)CC(F)(F)F.I.
What is the InChIKey of 1-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-2-propylguanidine;hydroiodide?
The InChIKey is DXGVMKMYIFNHEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21F3N4.HI/c1-3-5-15-9(14)16-6-4-7-17(2)8-10(11,12)13;/h3-8H2,1-2H3,(H3,14,15,16);1H.
What are the key properties of 1-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-2-propylguanidine;hydroiodide?
1-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-2-propylguanidine;hydroiodide has a molecular weight of 382.21 g/mol, XLogP of 1.80, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-2-propylguanidine;hydroiodide is sourced from PubChem (CID 75532965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).