C16H20N4O2S — CID 75533030
1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-[2-(2-ethyl-1,3-thiazol-4-yl)ethyl]guanidine (PubChem CID 75533030) has the molecular formula C16H20N4O2S and a molecular weight of 332.43 g/mol. Its IUPAC name is 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-[2-(2-ethyl-1,3-thiazol-4-yl)ethyl]guanidine.
| Compound Name | 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-[2-(2-ethyl-1,3-thiazol-4-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 75533030 |
| Molecular Formula | C16H20N4O2S |
| Molecular Weight | 332.43 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-[2-(2-ethyl-1,3-thiazol-4-yl)ethyl]guanidine |
| SMILES | CCc1nc(CC/N=C(\N)Nc2ccc3c(c2)OCCO3)cs1 |
| InChI | InChI=1S/C16H20N4O2S/c1-2-15-19-12(10-23-15)5-6-18-16(17)20-11-3-4-13-14(9-11)22-8-7-21-13/h3-4,9-10H,2,5-8H2,1H3,(H3,17,18,20) |
| InChIKey | STXCRBOPMBWESQ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 81.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.43 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|