About 2-[2-[ethyl(propan-2-yl)amino]ethyl]-1-(1-methoxypropan-2-yl)guanidine;hydroiodide
2-[2-[ethyl(propan-2-yl)amino]ethyl]-1-(1-methoxypropan-2-yl)guanidine;hydroiodide (PubChem CID 75533049) has the molecular formula C12H29IN4O
and a molecular weight of 372.30 g/mol. Its IUPAC name is 2-[2-[ethyl(propan-2-yl)amino]ethyl]-1-(1-methoxypropan-2-yl)guanidine;hydroiodide.
Molecular Properties
| Compound Name | 2-[2-[ethyl(propan-2-yl)amino]ethyl]-1-(1-methoxypropan-2-yl)guanidine;hydroiodide |
| PubChem CID | 75533049 |
| Molecular Formula | C12H29IN4O |
| Molecular Weight | 372.30 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | 2-[2-[ethyl(propan-2-yl)amino]ethyl]-1-(1-methoxypropan-2-yl)guanidine;hydroiodide |
| SMILES | CCN(CC/N=C(\N)NC(C)COC)C(C)C.I |
| InChI | InChI=1S/C12H28N4O.HI/c1-6-16(10(2)3)8-7-14-12(13)15-11(4)9-17-5;/h10-11H,6-9H2,1-5H3,(H3,13,14,15);1H |
| InChIKey | AKROHXMPIFNQEA-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 62.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.30 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-[ethyl(propan-2-yl)amino]ethyl]-1-(1-methoxypropan-2-yl)guanidine;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[ethyl(propan-2-yl)amino]ethyl]-1-(1-methoxypropan-2-yl)guanidine;hydroiodide?
The IUPAC name of 2-[2-[ethyl(propan-2-yl)amino]ethyl]-1-(1-methoxypropan-2-yl)guanidine;hydroiodide (CID 75533049) is 2-[2-[ethyl(propan-2-yl)amino]ethyl]-1-(1-methoxypropan-2-yl)guanidine;hydroiodide.
What is the SMILES notation for 2-[2-[ethyl(propan-2-yl)amino]ethyl]-1-(1-methoxypropan-2-yl)guanidine;hydroiodide?
The canonical SMILES for 2-[2-[ethyl(propan-2-yl)amino]ethyl]-1-(1-methoxypropan-2-yl)guanidine;hydroiodide is CCN(CC/N=C(\N)NC(C)COC)C(C)C.I.
What is the InChIKey of 2-[2-[ethyl(propan-2-yl)amino]ethyl]-1-(1-methoxypropan-2-yl)guanidine;hydroiodide?
The InChIKey is AKROHXMPIFNQEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H28N4O.HI/c1-6-16(10(2)3)8-7-14-12(13)15-11(4)9-17-5;/h10-11H,6-9H2,1-5H3,(H3,13,14,15);1H.
What are the key properties of 2-[2-[ethyl(propan-2-yl)amino]ethyl]-1-(1-methoxypropan-2-yl)guanidine;hydroiodide?
2-[2-[ethyl(propan-2-yl)amino]ethyl]-1-(1-methoxypropan-2-yl)guanidine;hydroiodide has a molecular weight of 372.30 g/mol, XLogP of 1.27, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[ethyl(propan-2-yl)amino]ethyl]-1-(1-methoxypropan-2-yl)guanidine;hydroiodide is sourced from PubChem (CID 75533049), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).