C15H32N4O — CID 75533319
1-butyl-3-[[1-(2-methoxyethyl)pyrrolidin-2-yl]methyl]-1,2-dimethylguanidine (PubChem CID 75533319) has the molecular formula C15H32N4O and a molecular weight of 284.45 g/mol. Its IUPAC name is 1-butyl-3-[[1-(2-methoxyethyl)pyrrolidin-2-yl]methyl]-1,2-dimethylguanidine.
| Compound Name | 1-butyl-3-[[1-(2-methoxyethyl)pyrrolidin-2-yl]methyl]-1,2-dimethylguanidine |
|---|---|
| PubChem CID | 75533319 |
| Molecular Formula | C15H32N4O |
| Molecular Weight | 284.45 g/mol |
| Exact Mass | 284.26 |
| IUPAC Name | 1-butyl-3-[[1-(2-methoxyethyl)pyrrolidin-2-yl]methyl]-1,2-dimethylguanidine |
| SMILES | CCCCN(C)/C(=N\C)NCC1CCCN1CCOC |
| InChI | InChI=1S/C15H32N4O/c1-5-6-9-18(3)15(16-2)17-13-14-8-7-10-19(14)11-12-20-4/h14H,5-13H2,1-4H3,(H,16,17) |
| InChIKey | SWTSUGOXDYQMSH-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 40.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.45 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|