About (E)-4,4-dimethyl-N-[1-(7H-purin-6-yl)piperidin-4-yl]pent-2-enamide
(E)-4,4-dimethyl-N-[1-(7H-purin-6-yl)piperidin-4-yl]pent-2-enamide (PubChem CID 75533505) has the molecular formula C17H24N6O
and a molecular weight of 328.42 g/mol. Its IUPAC name is (E)-4,4-dimethyl-N-[1-(7H-purin-6-yl)piperidin-4-yl]pent-2-enamide.
Molecular Properties
| Compound Name | (E)-4,4-dimethyl-N-[1-(7H-purin-6-yl)piperidin-4-yl]pent-2-enamide |
| PubChem CID | 75533505 |
| Molecular Formula | C17H24N6O |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.20 |
| IUPAC Name | (E)-4,4-dimethyl-N-[1-(7H-purin-6-yl)piperidin-4-yl]pent-2-enamide |
| SMILES | CC(C)(C)/C=C/C(=O)NC1CCN(c2ncnc3nc[nH]c23)CC1 |
| InChI | InChI=1S/C17H24N6O/c1-17(2,3)7-4-13(24)22-12-5-8-23(9-6-12)16-14-15(19-10-18-14)20-11-21-16/h4,7,10-12H,5-6,8-9H2,1-3H3,(H,22,24)(H,18,19,20,21)/b7-4+ |
| InChIKey | YJOZFNWCKDASFT-QPJJXVBHSA-N |
| XLogP | 2.04 |
| TPSA | 86.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-4,4-dimethyl-N-[1-(7H-purin-6-yl)piperidin-4-yl]pent-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-4,4-dimethyl-N-[1-(7H-purin-6-yl)piperidin-4-yl]pent-2-enamide?
The IUPAC name of (E)-4,4-dimethyl-N-[1-(7H-purin-6-yl)piperidin-4-yl]pent-2-enamide (CID 75533505) is (E)-4,4-dimethyl-N-[1-(7H-purin-6-yl)piperidin-4-yl]pent-2-enamide.
What is the SMILES notation for (E)-4,4-dimethyl-N-[1-(7H-purin-6-yl)piperidin-4-yl]pent-2-enamide?
The canonical SMILES for (E)-4,4-dimethyl-N-[1-(7H-purin-6-yl)piperidin-4-yl]pent-2-enamide is CC(C)(C)/C=C/C(=O)NC1CCN(c2ncnc3nc[nH]c23)CC1.
What is the InChIKey of (E)-4,4-dimethyl-N-[1-(7H-purin-6-yl)piperidin-4-yl]pent-2-enamide?
The InChIKey is YJOZFNWCKDASFT-QPJJXVBHSA-N. The full InChI is InChI=1S/C17H24N6O/c1-17(2,3)7-4-13(24)22-12-5-8-23(9-6-12)16-14-15(19-10-18-14)20-11-21-16/h4,7,10-12H,5-6,8-9H2,1-3H3,(H,22,24)(H,18,19,20,21)/b7-4+.
What are the key properties of (E)-4,4-dimethyl-N-[1-(7H-purin-6-yl)piperidin-4-yl]pent-2-enamide?
(E)-4,4-dimethyl-N-[1-(7H-purin-6-yl)piperidin-4-yl]pent-2-enamide has a molecular weight of 328.42 g/mol, XLogP of 2.04, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-4,4-dimethyl-N-[1-(7H-purin-6-yl)piperidin-4-yl]pent-2-enamide is sourced from PubChem (CID 75533505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).