About 4-N-cyclopropyl-4-N-[3-(2-methylphenyl)cyclobutyl]benzene-1,4-dicarboxamide
4-N-cyclopropyl-4-N-[3-(2-methylphenyl)cyclobutyl]benzene-1,4-dicarboxamide (PubChem CID 75533709) has the molecular formula C22H24N2O2
and a molecular weight of 348.45 g/mol. Its IUPAC name is 4-N-cyclopropyl-4-N-[3-(2-methylphenyl)cyclobutyl]benzene-1,4-dicarboxamide.
Molecular Properties
| Compound Name | 4-N-cyclopropyl-4-N-[3-(2-methylphenyl)cyclobutyl]benzene-1,4-dicarboxamide |
| PubChem CID | 75533709 |
| Molecular Formula | C22H24N2O2 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | 4-N-cyclopropyl-4-N-[3-(2-methylphenyl)cyclobutyl]benzene-1,4-dicarboxamide |
| SMILES | Cc1ccccc1C1CC(N(C(=O)c2ccc(C(N)=O)cc2)C2CC2)C1 |
| InChI | InChI=1S/C22H24N2O2/c1-14-4-2-3-5-20(14)17-12-19(13-17)24(18-10-11-18)22(26)16-8-6-15(7-9-16)21(23)25/h2-9,17-19H,10-13H2,1H3,(H2,23,25) |
| InChIKey | KIABZHPFXBHWBE-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-N-cyclopropyl-4-N-[3-(2-methylphenyl)cyclobutyl]benzene-1,4-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-N-cyclopropyl-4-N-[3-(2-methylphenyl)cyclobutyl]benzene-1,4-dicarboxamide?
The IUPAC name of 4-N-cyclopropyl-4-N-[3-(2-methylphenyl)cyclobutyl]benzene-1,4-dicarboxamide (CID 75533709) is 4-N-cyclopropyl-4-N-[3-(2-methylphenyl)cyclobutyl]benzene-1,4-dicarboxamide.
What is the SMILES notation for 4-N-cyclopropyl-4-N-[3-(2-methylphenyl)cyclobutyl]benzene-1,4-dicarboxamide?
The canonical SMILES for 4-N-cyclopropyl-4-N-[3-(2-methylphenyl)cyclobutyl]benzene-1,4-dicarboxamide is Cc1ccccc1C1CC(N(C(=O)c2ccc(C(N)=O)cc2)C2CC2)C1.
What is the InChIKey of 4-N-cyclopropyl-4-N-[3-(2-methylphenyl)cyclobutyl]benzene-1,4-dicarboxamide?
The InChIKey is KIABZHPFXBHWBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H24N2O2/c1-14-4-2-3-5-20(14)17-12-19(13-17)24(18-10-11-18)22(26)16-8-6-15(7-9-16)21(23)25/h2-9,17-19H,10-13H2,1H3,(H2,23,25).
What are the key properties of 4-N-cyclopropyl-4-N-[3-(2-methylphenyl)cyclobutyl]benzene-1,4-dicarboxamide?
4-N-cyclopropyl-4-N-[3-(2-methylphenyl)cyclobutyl]benzene-1,4-dicarboxamide has a molecular weight of 348.45 g/mol, XLogP of 3.64, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-N-cyclopropyl-4-N-[3-(2-methylphenyl)cyclobutyl]benzene-1,4-dicarboxamide is sourced from PubChem (CID 75533709), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).