About N-(4-methylcyclohexyl)-3,5-bis(trifluoromethyl)-1H-pyrazole-4-carboxamide
N-(4-methylcyclohexyl)-3,5-bis(trifluoromethyl)-1H-pyrazole-4-carboxamide (PubChem CID 75534029) has the molecular formula C13H15F6N3O
and a molecular weight of 343.27 g/mol. Its IUPAC name is N-(4-methylcyclohexyl)-3,5-bis(trifluoromethyl)-1H-pyrazole-4-carboxamide.
Molecular Properties
| Compound Name | N-(4-methylcyclohexyl)-3,5-bis(trifluoromethyl)-1H-pyrazole-4-carboxamide |
| PubChem CID | 75534029 |
| Molecular Formula | C13H15F6N3O |
| Molecular Weight | 343.27 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | N-(4-methylcyclohexyl)-3,5-bis(trifluoromethyl)-1H-pyrazole-4-carboxamide |
| SMILES | CC1CCC(NC(=O)c2c(C(F)(F)F)n[nH]c2C(F)(F)F)CC1 |
| InChI | InChI=1S/C13H15F6N3O/c1-6-2-4-7(5-3-6)20-11(23)8-9(12(14,15)16)21-22-10(8)13(17,18)19/h6-7H,2-5H2,1H3,(H,20,23)(H,21,22) |
| InChIKey | ZUABGSKWVQMRJG-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.27 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(4-methylcyclohexyl)-3,5-bis(trifluoromethyl)-1H-pyrazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-methylcyclohexyl)-3,5-bis(trifluoromethyl)-1H-pyrazole-4-carboxamide?
The IUPAC name of N-(4-methylcyclohexyl)-3,5-bis(trifluoromethyl)-1H-pyrazole-4-carboxamide (CID 75534029) is N-(4-methylcyclohexyl)-3,5-bis(trifluoromethyl)-1H-pyrazole-4-carboxamide.
What is the SMILES notation for N-(4-methylcyclohexyl)-3,5-bis(trifluoromethyl)-1H-pyrazole-4-carboxamide?
The canonical SMILES for N-(4-methylcyclohexyl)-3,5-bis(trifluoromethyl)-1H-pyrazole-4-carboxamide is CC1CCC(NC(=O)c2c(C(F)(F)F)n[nH]c2C(F)(F)F)CC1.
What is the InChIKey of N-(4-methylcyclohexyl)-3,5-bis(trifluoromethyl)-1H-pyrazole-4-carboxamide?
The InChIKey is ZUABGSKWVQMRJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15F6N3O/c1-6-2-4-7(5-3-6)20-11(23)8-9(12(14,15)16)21-22-10(8)13(17,18)19/h6-7H,2-5H2,1H3,(H,20,23)(H,21,22).
What are the key properties of N-(4-methylcyclohexyl)-3,5-bis(trifluoromethyl)-1H-pyrazole-4-carboxamide?
N-(4-methylcyclohexyl)-3,5-bis(trifluoromethyl)-1H-pyrazole-4-carboxamide has a molecular weight of 343.27 g/mol, XLogP of 3.76, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-methylcyclohexyl)-3,5-bis(trifluoromethyl)-1H-pyrazole-4-carboxamide is sourced from PubChem (CID 75534029), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).