C21H17FN2O6 — CID 7553428
[2-[[2-(4-fluoroanilino)-2-oxoethyl]amino]-2-oxoethyl] 1,4-dihydroxynaphthalene-2-carboxylate (PubChem CID 7553428) has the molecular formula C21H17FN2O6 and a molecular weight of 412.37 g/mol. Its IUPAC name is [2-[[2-(4-fluoroanilino)-2-oxoethyl]amino]-2-oxoethyl] 1,4-dihydroxynaphthalene-2-carboxylate.
| Compound Name | [2-[[2-(4-fluoroanilino)-2-oxoethyl]amino]-2-oxoethyl] 1,4-dihydroxynaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 7553428 |
| Molecular Formula | C21H17FN2O6 |
| Molecular Weight | 412.37 g/mol |
| Exact Mass | 412.11 |
| IUPAC Name | [2-[[2-(4-fluoroanilino)-2-oxoethyl]amino]-2-oxoethyl] 1,4-dihydroxynaphthalene-2-carboxylate |
| SMILES | O=C(COC(=O)c1cc(O)c2ccccc2c1O)NCC(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C21H17FN2O6/c22-12-5-7-13(8-6-12)24-18(26)10-23-19(27)11-30-21(29)16-9-17(25)14-3-1-2-4-15(14)20(16)28/h1-9,25,28H,10-11H2,(H,23,27)(H,24,26) |
| InChIKey | UPSGUJOZAZEEDZ-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 124.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.37 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|