C20H28N4O6 — CID 75534327
5-(methoxymethyl)-N-[3-[[5-(methoxymethyl)-1,2-oxazole-3-carbonyl]amino]-2,2,4,4-tetramethylcyclobutyl]-1,2-oxazole-3-carboxamide (PubChem CID 75534327) has the molecular formula C20H28N4O6 and a molecular weight of 420.47 g/mol. Its IUPAC name is 5-(methoxymethyl)-N-[3-[[5-(methoxymethyl)-1,2-oxazole-3-carbonyl]amino]-2,2,4,4-tetramethylcyclobutyl]-1,2-oxazole-3-carboxamide.
| Compound Name | 5-(methoxymethyl)-N-[3-[[5-(methoxymethyl)-1,2-oxazole-3-carbonyl]amino]-2,2,4,4-tetramethylcyclobutyl]-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 75534327 |
| Molecular Formula | C20H28N4O6 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.20 |
| IUPAC Name | 5-(methoxymethyl)-N-[3-[[5-(methoxymethyl)-1,2-oxazole-3-carbonyl]amino]-2,2,4,4-tetramethylcyclobutyl]-1,2-oxazole-3-carboxamide |
| SMILES | COCc1cc(C(=O)NC2C(C)(C)C(NC(=O)c3cc(COC)on3)C2(C)C)no1 |
| InChI | InChI=1S/C20H28N4O6/c1-19(2)17(21-15(25)13-7-11(9-27-5)29-23-13)20(3,4)18(19)22-16(26)14-8-12(10-28-6)30-24-14/h7-8,17-18H,9-10H2,1-6H3,(H,21,25)(H,22,26) |
| InChIKey | BEWPKUUCTVDYPT-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 128.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |