C16H34N2O6S2 — CID 75534456
3-methoxy-N-[3-(3-methoxypropylsulfonylamino)-2,2,4,4-tetramethylcyclobutyl]propane-1-sulfonamide (PubChem CID 75534456) has the molecular formula C16H34N2O6S2 and a molecular weight of 414.59 g/mol. Its IUPAC name is 3-methoxy-N-[3-(3-methoxypropylsulfonylamino)-2,2,4,4-tetramethylcyclobutyl]propane-1-sulfonamide.
| Compound Name | 3-methoxy-N-[3-(3-methoxypropylsulfonylamino)-2,2,4,4-tetramethylcyclobutyl]propane-1-sulfonamide |
|---|---|
| PubChem CID | 75534456 |
| Molecular Formula | C16H34N2O6S2 |
| Molecular Weight | 414.59 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | 3-methoxy-N-[3-(3-methoxypropylsulfonylamino)-2,2,4,4-tetramethylcyclobutyl]propane-1-sulfonamide |
| SMILES | COCCCS(=O)(=O)NC1C(C)(C)C(NS(=O)(=O)CCCOC)C1(C)C |
| InChI | InChI=1S/C16H34N2O6S2/c1-15(2)13(17-25(19,20)11-7-9-23-5)16(3,4)14(15)18-26(21,22)12-8-10-24-6/h13-14,17-18H,7-12H2,1-6H3 |
| InChIKey | XJUVQAWOPHJJIS-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.59 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|