About N'-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]pyrrolidine-1-carboximidamide
N'-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]pyrrolidine-1-carboximidamide (PubChem CID 75534572) has the molecular formula C17H23N5
and a molecular weight of 297.41 g/mol. Its IUPAC name is N'-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]pyrrolidine-1-carboximidamide.
Molecular Properties
| Compound Name | N'-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]pyrrolidine-1-carboximidamide |
| PubChem CID | 75534572 |
| Molecular Formula | C17H23N5 |
| Molecular Weight | 297.41 g/mol |
| Exact Mass | 297.20 |
| IUPAC Name | N'-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]pyrrolidine-1-carboximidamide |
| SMILES | Cc1nn(-c2ccccc2)c(C)c1C/N=C(\N)N1CCCC1 |
| InChI | InChI=1S/C17H23N5/c1-13-16(12-19-17(18)21-10-6-7-11-21)14(2)22(20-13)15-8-4-3-5-9-15/h3-5,8-9H,6-7,10-12H2,1-2H3,(H2,18,19) |
| InChIKey | GOYJQGAXHOYENR-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 59.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.41 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]pyrrolidine-1-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]pyrrolidine-1-carboximidamide?
The IUPAC name of N'-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]pyrrolidine-1-carboximidamide (CID 75534572) is N'-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]pyrrolidine-1-carboximidamide.
What is the SMILES notation for N'-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]pyrrolidine-1-carboximidamide?
The canonical SMILES for N'-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]pyrrolidine-1-carboximidamide is Cc1nn(-c2ccccc2)c(C)c1C/N=C(\N)N1CCCC1.
What is the InChIKey of N'-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]pyrrolidine-1-carboximidamide?
The InChIKey is GOYJQGAXHOYENR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23N5/c1-13-16(12-19-17(18)21-10-6-7-11-21)14(2)22(20-13)15-8-4-3-5-9-15/h3-5,8-9H,6-7,10-12H2,1-2H3,(H2,18,19).
What are the key properties of N'-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]pyrrolidine-1-carboximidamide?
N'-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]pyrrolidine-1-carboximidamide has a molecular weight of 297.41 g/mol, XLogP of 2.40, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]pyrrolidine-1-carboximidamide is sourced from PubChem (CID 75534572), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).