C15H27BrN4O2 — CID 75535404
2-[2-(furan-2-yl)-2-piperidin-1-ylethyl]-1-(2-methoxyethyl)guanidine;hydrobromide (PubChem CID 75535404) has the molecular formula C15H27BrN4O2 and a molecular weight of 375.31 g/mol. Its IUPAC name is 2-[2-(furan-2-yl)-2-piperidin-1-ylethyl]-1-(2-methoxyethyl)guanidine;hydrobromide.
| Compound Name | 2-[2-(furan-2-yl)-2-piperidin-1-ylethyl]-1-(2-methoxyethyl)guanidine;hydrobromide |
|---|---|
| PubChem CID | 75535404 |
| Molecular Formula | C15H27BrN4O2 |
| Molecular Weight | 375.31 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | 2-[2-(furan-2-yl)-2-piperidin-1-ylethyl]-1-(2-methoxyethyl)guanidine;hydrobromide |
| SMILES | Br.COCCN/C(N)=N/CC(c1ccco1)N1CCCCC1 |
| InChI | InChI=1S/C15H26N4O2.BrH/c1-20-11-7-17-15(16)18-12-13(14-6-5-10-21-14)19-8-3-2-4-9-19;/h5-6,10,13H,2-4,7-9,11-12H2,1H3,(H3,16,17,18);1H |
| InChIKey | IMABTUVJGKPBER-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.31 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|