C15H19N3O2S — CID 75535689
N,5-dimethyl-N-(1-oxothian-4-yl)-1H-indazole-3-carboxamide (PubChem CID 75535689) has the molecular formula C15H19N3O2S and a molecular weight of 305.40 g/mol. Its IUPAC name is N,5-dimethyl-N-(1-oxothian-4-yl)-1H-indazole-3-carboxamide.
| Compound Name | N,5-dimethyl-N-(1-oxothian-4-yl)-1H-indazole-3-carboxamide |
|---|---|
| PubChem CID | 75535689 |
| Molecular Formula | C15H19N3O2S |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | N,5-dimethyl-N-(1-oxothian-4-yl)-1H-indazole-3-carboxamide |
| SMILES | Cc1ccc2[nH]nc(C(=O)N(C)C3CCS(=O)CC3)c2c1 |
| InChI | InChI=1S/C15H19N3O2S/c1-10-3-4-13-12(9-10)14(17-16-13)15(19)18(2)11-5-7-21(20)8-6-11/h3-4,9,11H,5-8H2,1-2H3,(H,16,17) |
| InChIKey | KFUIPXQOXXFUIJ-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |