C25H39NO3 — CID 75536031
(9E)-4-methoxy-9,13,14-trimethyl-16-(2-methylpropyl)-17-azatricyclo[9.7.0.01,15]octadeca-9,12-diene-2,18-dione (PubChem CID 75536031) has the molecular formula C25H39NO3 and a molecular weight of 401.59 g/mol. Its IUPAC name is (9E)-4-methoxy-9,13,14-trimethyl-16-(2-methylpropyl)-17-azatricyclo[9.7.0.01,15]octadeca-9,12-diene-2,18-dione.
| Compound Name | (9E)-4-methoxy-9,13,14-trimethyl-16-(2-methylpropyl)-17-azatricyclo[9.7.0.01,15]octadeca-9,12-diene-2,18-dione |
|---|---|
| PubChem CID | 75536031 |
| Molecular Formula | C25H39NO3 |
| Molecular Weight | 401.59 g/mol |
| Exact Mass | 401.29 |
| IUPAC Name | (9E)-4-methoxy-9,13,14-trimethyl-16-(2-methylpropyl)-17-azatricyclo[9.7.0.01,15]octadeca-9,12-diene-2,18-dione |
| SMILES | COC1CCCC/C(C)=C/C2C=C(C)C(C)C3C(CC(C)C)NC(=O)C23C(=O)C1 |
| InChI | InChI=1S/C25H39NO3/c1-15(2)11-21-23-18(5)17(4)13-19-12-16(3)9-7-8-10-20(29-6)14-22(27)25(19,23)24(28)26-21/h12-13,15,18-21,23H,7-11,14H2,1-6H3,(H,26,28)/b16-12+ |
| InChIKey | BECNNJLLIXQSGY-FOWTUZBSSA-N |
| XLogP | 4.84 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.59 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|