C25H45N3O2 — CID 75536048
3-[(3S,3aR,6S,7aS)-6-hydroxy-1,1,6-trimethyl-3-[(1-methylpiperidin-4-yl)amino]-2,3,4,5,7,7a-hexahydroinden-3a-yl]-1-pyrrolidin-1-ylpropan-1-one (PubChem CID 75536048) has the molecular formula C25H45N3O2 and a molecular weight of 419.65 g/mol. Its IUPAC name is 3-[(3S,3aR,6S,7aS)-6-hydroxy-1,1,6-trimethyl-3-[(1-methylpiperidin-4-yl)amino]-2,3,4,5,7,7a-hexahydroinden-3a-yl]-1-pyrrolidin-1-ylpropan-1-one.
| Compound Name | 3-[(3S,3aR,6S,7aS)-6-hydroxy-1,1,6-trimethyl-3-[(1-methylpiperidin-4-yl)amino]-2,3,4,5,7,7a-hexahydroinden-3a-yl]-1-pyrrolidin-1-ylpropan-1-one |
|---|---|
| PubChem CID | 75536048 |
| Molecular Formula | C25H45N3O2 |
| Molecular Weight | 419.65 g/mol |
| Exact Mass | 419.35 |
| IUPAC Name | 3-[(3S,3aR,6S,7aS)-6-hydroxy-1,1,6-trimethyl-3-[(1-methylpiperidin-4-yl)amino]-2,3,4,5,7,7a-hexahydroinden-3a-yl]-1-pyrrolidin-1-ylpropan-1-one |
| SMILES | CN1CCC(N[C@H]2CC(C)(C)[C@@H]3C[C@@](C)(O)CC[C@]23CCC(=O)N2CCCC2)CC1 |
| InChI | InChI=1S/C25H45N3O2/c1-23(2)18-21(26-19-8-15-27(4)16-9-19)25(12-11-24(3,30)17-20(23)25)10-7-22(29)28-13-5-6-14-28/h19-21,26,30H,5-18H2,1-4H3/t20-,21-,24-,25-/m0/s1 |
| InChIKey | PLKNVLWUORWSNS-NBMBROAQSA-N |
| XLogP | 3.41 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.65 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |