C16H20N4O3 — CID 75536078
N-[(1R,2S,3R,5R)-2,3-dihydroxy-5-pyridin-3-ylcyclopentyl]-2,5-dimethylpyrazole-3-carboxamide (PubChem CID 75536078) has the molecular formula C16H20N4O3 and a molecular weight of 316.36 g/mol. Its IUPAC name is N-[(1R,2S,3R,5R)-2,3-dihydroxy-5-pyridin-3-ylcyclopentyl]-2,5-dimethylpyrazole-3-carboxamide.
| Compound Name | N-[(1R,2S,3R,5R)-2,3-dihydroxy-5-pyridin-3-ylcyclopentyl]-2,5-dimethylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 75536078 |
| Molecular Formula | C16H20N4O3 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | N-[(1R,2S,3R,5R)-2,3-dihydroxy-5-pyridin-3-ylcyclopentyl]-2,5-dimethylpyrazole-3-carboxamide |
| SMILES | Cc1cc(C(=O)N[C@H]2[C@H](O)[C@H](O)C[C@@H]2c2cccnc2)n(C)n1 |
| InChI | InChI=1S/C16H20N4O3/c1-9-6-12(20(2)19-9)16(23)18-14-11(7-13(21)15(14)22)10-4-3-5-17-8-10/h3-6,8,11,13-15,21-22H,7H2,1-2H3,(H,18,23)/t11-,13-,14-,15-/m1/s1 |
| InChIKey | OYFVRRZDGDMTRB-NMFUWQPSSA-N |
| XLogP | 0.13 |
| TPSA | 100.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |