C19H21FN2O4 — CID 75536643
4-fluoro-N-[[(2R,3S,4R)-3-hydroxy-4-[(2-hydroxyphenyl)methylamino]oxolan-2-yl]methyl]benzamide (PubChem CID 75536643) has the molecular formula C19H21FN2O4 and a molecular weight of 360.39 g/mol. Its IUPAC name is 4-fluoro-N-[[(2R,3S,4R)-3-hydroxy-4-[(2-hydroxyphenyl)methylamino]oxolan-2-yl]methyl]benzamide.
| Compound Name | 4-fluoro-N-[[(2R,3S,4R)-3-hydroxy-4-[(2-hydroxyphenyl)methylamino]oxolan-2-yl]methyl]benzamide |
|---|---|
| PubChem CID | 75536643 |
| Molecular Formula | C19H21FN2O4 |
| Molecular Weight | 360.39 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | 4-fluoro-N-[[(2R,3S,4R)-3-hydroxy-4-[(2-hydroxyphenyl)methylamino]oxolan-2-yl]methyl]benzamide |
| SMILES | O=C(NC[C@H]1OC[C@@H](NCc2ccccc2O)[C@@H]1O)c1ccc(F)cc1 |
| InChI | InChI=1S/C19H21FN2O4/c20-14-7-5-12(6-8-14)19(25)22-10-17-18(24)15(11-26-17)21-9-13-3-1-2-4-16(13)23/h1-8,15,17-18,21,23-24H,9-11H2,(H,22,25)/t15-,17-,18+/m1/s1 |
| InChIKey | JFEFBAGRGRHQND-NXHRZFHOSA-N |
| XLogP | 1.18 |
| TPSA | 90.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.39 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|