About N-[[(2R,3S,4R)-4-amino-3-hydroxyoxolan-2-yl]methyl]methanesulfonamide
N-[[(2R,3S,4R)-4-amino-3-hydroxyoxolan-2-yl]methyl]methanesulfonamide (PubChem CID 75536651) has the molecular formula C6H14N2O4S
and a molecular weight of 210.25 g/mol. Its IUPAC name is N-[[(2R,3S,4R)-4-amino-3-hydroxyoxolan-2-yl]methyl]methanesulfonamide.
Molecular Properties
| Compound Name | N-[[(2R,3S,4R)-4-amino-3-hydroxyoxolan-2-yl]methyl]methanesulfonamide |
| PubChem CID | 75536651 |
| Molecular Formula | C6H14N2O4S |
| Molecular Weight | 210.25 g/mol |
| Exact Mass | 210.07 |
| IUPAC Name | N-[[(2R,3S,4R)-4-amino-3-hydroxyoxolan-2-yl]methyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NC[C@H]1OC[C@@H](N)[C@@H]1O |
| InChI | InChI=1S/C6H14N2O4S/c1-13(10,11)8-2-5-6(9)4(7)3-12-5/h4-6,8-9H,2-3,7H2,1H3/t4-,5-,6+/m1/s1 |
| InChIKey | VOPFHBRXLKQFGO-PBXRRBTRSA-N |
| XLogP | -2.38 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.25 |
| LogP ≤ 5 | -2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[[(2R,3S,4R)-4-amino-3-hydroxyoxolan-2-yl]methyl]methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[(2R,3S,4R)-4-amino-3-hydroxyoxolan-2-yl]methyl]methanesulfonamide?
The IUPAC name of N-[[(2R,3S,4R)-4-amino-3-hydroxyoxolan-2-yl]methyl]methanesulfonamide (CID 75536651) is N-[[(2R,3S,4R)-4-amino-3-hydroxyoxolan-2-yl]methyl]methanesulfonamide.
What is the SMILES notation for N-[[(2R,3S,4R)-4-amino-3-hydroxyoxolan-2-yl]methyl]methanesulfonamide?
The canonical SMILES for N-[[(2R,3S,4R)-4-amino-3-hydroxyoxolan-2-yl]methyl]methanesulfonamide is CS(=O)(=O)NC[C@H]1OC[C@@H](N)[C@@H]1O.
What is the InChIKey of N-[[(2R,3S,4R)-4-amino-3-hydroxyoxolan-2-yl]methyl]methanesulfonamide?
The InChIKey is VOPFHBRXLKQFGO-PBXRRBTRSA-N. The full InChI is InChI=1S/C6H14N2O4S/c1-13(10,11)8-2-5-6(9)4(7)3-12-5/h4-6,8-9H,2-3,7H2,1H3/t4-,5-,6+/m1/s1.
What are the key properties of N-[[(2R,3S,4R)-4-amino-3-hydroxyoxolan-2-yl]methyl]methanesulfonamide?
N-[[(2R,3S,4R)-4-amino-3-hydroxyoxolan-2-yl]methyl]methanesulfonamide has a molecular weight of 210.25 g/mol, XLogP of -2.38, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[(2R,3S,4R)-4-amino-3-hydroxyoxolan-2-yl]methyl]methanesulfonamide is sourced from PubChem (CID 75536651), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).