C16H25N3O4 — CID 75536732
1-[[(2R,3S,4R)-3-hydroxy-4-[(2-hydroxyphenyl)methylamino]oxolan-2-yl]methyl]-3-propan-2-ylurea (PubChem CID 75536732) has the molecular formula C16H25N3O4 and a molecular weight of 323.39 g/mol. Its IUPAC name is 1-[[(2R,3S,4R)-3-hydroxy-4-[(2-hydroxyphenyl)methylamino]oxolan-2-yl]methyl]-3-propan-2-ylurea.
| Compound Name | 1-[[(2R,3S,4R)-3-hydroxy-4-[(2-hydroxyphenyl)methylamino]oxolan-2-yl]methyl]-3-propan-2-ylurea |
|---|---|
| PubChem CID | 75536732 |
| Molecular Formula | C16H25N3O4 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.18 |
| IUPAC Name | 1-[[(2R,3S,4R)-3-hydroxy-4-[(2-hydroxyphenyl)methylamino]oxolan-2-yl]methyl]-3-propan-2-ylurea |
| SMILES | CC(C)NC(=O)NC[C@H]1OC[C@@H](NCc2ccccc2O)[C@@H]1O |
| InChI | InChI=1S/C16H25N3O4/c1-10(2)19-16(22)18-8-14-15(21)12(9-23-14)17-7-11-5-3-4-6-13(11)20/h3-6,10,12,14-15,17,20-21H,7-9H2,1-2H3,(H2,18,19,22)/t12-,14-,15+/m1/s1 |
| InChIKey | PKPYERGFXOKKHI-YUELXQCFSA-N |
| XLogP | 0.32 |
| TPSA | 102.85 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|