About 9H-fluorene-3,9-diol
9H-fluorene-3,9-diol (PubChem CID 75537244) has the molecular formula C13H10O2
and a molecular weight of 198.22 g/mol. Its IUPAC name is 9H-fluorene-3,9-diol.
Molecular Properties
| Compound Name | 9H-fluorene-3,9-diol |
| PubChem CID | 75537244 |
| Molecular Formula | C13H10O2 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.07 |
| IUPAC Name | 9H-fluorene-3,9-diol |
| SMILES | Oc1ccc2c(c1)-c1ccccc1C2O |
| InChI | InChI=1S/C13H10O2/c14-8-5-6-11-12(7-8)9-3-1-2-4-10(9)13(11)15/h1-7,13-15H |
| InChIKey | MXVUUOPKYAQYPU-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 9H-fluorene-3,9-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9H-fluorene-3,9-diol?
The IUPAC name of 9H-fluorene-3,9-diol (CID 75537244) is 9H-fluorene-3,9-diol.
What is the SMILES notation for 9H-fluorene-3,9-diol?
The canonical SMILES for 9H-fluorene-3,9-diol is Oc1ccc2c(c1)-c1ccccc1C2O.
What is the InChIKey of 9H-fluorene-3,9-diol?
The InChIKey is MXVUUOPKYAQYPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10O2/c14-8-5-6-11-12(7-8)9-3-1-2-4-10(9)13(11)15/h1-7,13-15H.
What are the key properties of 9H-fluorene-3,9-diol?
9H-fluorene-3,9-diol has a molecular weight of 198.22 g/mol, XLogP of 2.45, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9H-fluorene-3,9-diol is sourced from PubChem (CID 75537244), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).