About N'-[3-(2-fluorophenyl)-2,6-dioxopyrimidin-4-yl]-N,N-dimethylmethanimidamide
N'-[3-(2-fluorophenyl)-2,6-dioxopyrimidin-4-yl]-N,N-dimethylmethanimidamide (PubChem CID 75537581) has the molecular formula C13H13FN4O2
and a molecular weight of 276.27 g/mol. Its IUPAC name is N'-[3-(2-fluorophenyl)-2,6-dioxopyrimidin-4-yl]-N,N-dimethylmethanimidamide.
Molecular Properties
| Compound Name | N'-[3-(2-fluorophenyl)-2,6-dioxopyrimidin-4-yl]-N,N-dimethylmethanimidamide |
| PubChem CID | 75537581 |
| Molecular Formula | C13H13FN4O2 |
| Molecular Weight | 276.27 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | N'-[3-(2-fluorophenyl)-2,6-dioxopyrimidin-4-yl]-N,N-dimethylmethanimidamide |
| SMILES | CN(C)/C=N/c1cc(=O)[nH]c(=O)n1-c1ccccc1F |
| InChI | InChI=1S/C13H13FN4O2/c1-17(2)8-15-11-7-12(19)16-13(20)18(11)10-6-4-3-5-9(10)14/h3-8H,1-2H3,(H,16,19,20)/b15-8+ |
| InChIKey | IHIAEIQMMHGHDR-OVCLIPMQSA-N |
| XLogP | 0.89 |
| TPSA | 70.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.27 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-[3-(2-fluorophenyl)-2,6-dioxopyrimidin-4-yl]-N,N-dimethylmethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[3-(2-fluorophenyl)-2,6-dioxopyrimidin-4-yl]-N,N-dimethylmethanimidamide?
The IUPAC name of N'-[3-(2-fluorophenyl)-2,6-dioxopyrimidin-4-yl]-N,N-dimethylmethanimidamide (CID 75537581) is N'-[3-(2-fluorophenyl)-2,6-dioxopyrimidin-4-yl]-N,N-dimethylmethanimidamide.
What is the SMILES notation for N'-[3-(2-fluorophenyl)-2,6-dioxopyrimidin-4-yl]-N,N-dimethylmethanimidamide?
The canonical SMILES for N'-[3-(2-fluorophenyl)-2,6-dioxopyrimidin-4-yl]-N,N-dimethylmethanimidamide is CN(C)/C=N/c1cc(=O)[nH]c(=O)n1-c1ccccc1F.
What is the InChIKey of N'-[3-(2-fluorophenyl)-2,6-dioxopyrimidin-4-yl]-N,N-dimethylmethanimidamide?
The InChIKey is IHIAEIQMMHGHDR-OVCLIPMQSA-N. The full InChI is InChI=1S/C13H13FN4O2/c1-17(2)8-15-11-7-12(19)16-13(20)18(11)10-6-4-3-5-9(10)14/h3-8H,1-2H3,(H,16,19,20)/b15-8+.
What are the key properties of N'-[3-(2-fluorophenyl)-2,6-dioxopyrimidin-4-yl]-N,N-dimethylmethanimidamide?
N'-[3-(2-fluorophenyl)-2,6-dioxopyrimidin-4-yl]-N,N-dimethylmethanimidamide has a molecular weight of 276.27 g/mol, XLogP of 0.89, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[3-(2-fluorophenyl)-2,6-dioxopyrimidin-4-yl]-N,N-dimethylmethanimidamide is sourced from PubChem (CID 75537581), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).