C20H16FN3O2 — CID 75538254
N-[1-[(2-fluorophenyl)methyl]pyrazol-4-yl]-2H-chromene-3-carboxamide (PubChem CID 75538254) has the molecular formula C20H16FN3O2 and a molecular weight of 349.37 g/mol. Its IUPAC name is N-[1-[(2-fluorophenyl)methyl]pyrazol-4-yl]-2H-chromene-3-carboxamide.
| Compound Name | N-[1-[(2-fluorophenyl)methyl]pyrazol-4-yl]-2H-chromene-3-carboxamide |
|---|---|
| PubChem CID | 75538254 |
| Molecular Formula | C20H16FN3O2 |
| Molecular Weight | 349.37 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | N-[1-[(2-fluorophenyl)methyl]pyrazol-4-yl]-2H-chromene-3-carboxamide |
| SMILES | O=C(Nc1cnn(Cc2ccccc2F)c1)C1=Cc2ccccc2OC1 |
| InChI | InChI=1S/C20H16FN3O2/c21-18-7-3-1-6-15(18)11-24-12-17(10-22-24)23-20(25)16-9-14-5-2-4-8-19(14)26-13-16/h1-10,12H,11,13H2,(H,23,25) |
| InChIKey | RFYYUZKWWXXEGR-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.37 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |