C13H12Cl2N2O2S — CID 75538652
4-chloro-N-(5-chloro-4,6-dimethyl-3-pyridinyl)benzenesulfonamide (PubChem CID 75538652) has the molecular formula C13H12Cl2N2O2S and a molecular weight of 331.22 g/mol. Its IUPAC name is 4-chloro-N-(5-chloro-4,6-dimethyl-3-pyridinyl)benzenesulfonamide.
| Compound Name | 4-chloro-N-(5-chloro-4,6-dimethyl-3-pyridinyl)benzenesulfonamide |
|---|---|
| PubChem CID | 75538652 |
| Molecular Formula | C13H12Cl2N2O2S |
| Molecular Weight | 331.22 g/mol |
| Exact Mass | 330.00 |
| IUPAC Name | 4-chloro-N-(5-chloro-4,6-dimethyl-3-pyridinyl)benzenesulfonamide |
| SMILES | Cc1ncc(NS(=O)(=O)c2ccc(Cl)cc2)c(C)c1Cl |
| InChI | InChI=1S/C13H12Cl2N2O2S/c1-8-12(7-16-9(2)13(8)15)17-20(18,19)11-5-3-10(14)4-6-11/h3-7,17H,1-2H3 |
| InChIKey | PZAWPVRQXLHUOZ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.22 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |