C16H21ClN6O — CID 75538894
5-chloro-N-[(E)-[4-(dimethylamino)phenyl]methylideneamino]-2-(oxan-2-yl)-1,2,4-triazol-3-amine (PubChem CID 75538894) has the molecular formula C16H21ClN6O and a molecular weight of 348.84 g/mol. Its IUPAC name is 5-chloro-N-[(E)-[4-(dimethylamino)phenyl]methylideneamino]-2-(oxan-2-yl)-1,2,4-triazol-3-amine.
| Compound Name | 5-chloro-N-[(E)-[4-(dimethylamino)phenyl]methylideneamino]-2-(oxan-2-yl)-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 75538894 |
| Molecular Formula | C16H21ClN6O |
| Molecular Weight | 348.84 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | 5-chloro-N-[(E)-[4-(dimethylamino)phenyl]methylideneamino]-2-(oxan-2-yl)-1,2,4-triazol-3-amine |
| SMILES | CN(C)c1ccc(/C=N/Nc2nc(Cl)nn2C2CCCCO2)cc1 |
| InChI | InChI=1S/C16H21ClN6O/c1-22(2)13-8-6-12(7-9-13)11-18-20-16-19-15(17)21-23(16)14-5-3-4-10-24-14/h6-9,11,14H,3-5,10H2,1-2H3,(H,19,20,21)/b18-11+ |
| InChIKey | HSNXPKYRSZCILK-WOJGMQOQSA-N |
| XLogP | 3.14 |
| TPSA | 67.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.84 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_anil_di_alk(35)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|