About (Z)-bis[1-(1-adamantyl)-1,2,4-triazol-3-yl]diazene
(Z)-bis[1-(1-adamantyl)-1,2,4-triazol-3-yl]diazene (PubChem CID 75538901) has the molecular formula C24H32N8
and a molecular weight of 432.58 g/mol. Its IUPAC name is (Z)-bis[1-(1-adamantyl)-1,2,4-triazol-3-yl]diazene.
Molecular Properties
| Compound Name | (Z)-bis[1-(1-adamantyl)-1,2,4-triazol-3-yl]diazene |
| PubChem CID | 75538901 |
| Molecular Formula | C24H32N8 |
| Molecular Weight | 432.58 g/mol |
| Exact Mass | 432.27 |
| IUPAC Name | (Z)-bis[1-(1-adamantyl)-1,2,4-triazol-3-yl]diazene |
| SMILES | c1nc(/N=N\c2ncn(C34CC5CC(CC(C5)C3)C4)n2)nn1C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C24H32N8/c1-15-2-17-3-16(1)8-23(7-15,9-17)31-13-25-21(29-31)27-28-22-26-14-32(30-22)24-10-18-4-19(11-24)6-20(5-18)12-24/h13-20H,1-12H2/b28-27- |
| InChIKey | HYRDSCVSTWCKJS-DQSJHHFOSA-N |
| XLogP | 5.14 |
| TPSA | 86.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 432.58 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze (Z)-bis[1-(1-adamantyl)-1,2,4-triazol-3-yl]diazene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-bis[1-(1-adamantyl)-1,2,4-triazol-3-yl]diazene?
The IUPAC name of (Z)-bis[1-(1-adamantyl)-1,2,4-triazol-3-yl]diazene (CID 75538901) is (Z)-bis[1-(1-adamantyl)-1,2,4-triazol-3-yl]diazene.
What is the SMILES notation for (Z)-bis[1-(1-adamantyl)-1,2,4-triazol-3-yl]diazene?
The canonical SMILES for (Z)-bis[1-(1-adamantyl)-1,2,4-triazol-3-yl]diazene is c1nc(/N=N\c2ncn(C34CC5CC(CC(C5)C3)C4)n2)nn1C12CC3CC(CC(C3)C1)C2.
What is the InChIKey of (Z)-bis[1-(1-adamantyl)-1,2,4-triazol-3-yl]diazene?
The InChIKey is HYRDSCVSTWCKJS-DQSJHHFOSA-N. The full InChI is InChI=1S/C24H32N8/c1-15-2-17-3-16(1)8-23(7-15,9-17)31-13-25-21(29-31)27-28-22-26-14-32(30-22)24-10-18-4-19(11-24)6-20(5-18)12-24/h13-20H,1-12H2/b28-27-.
What are the key properties of (Z)-bis[1-(1-adamantyl)-1,2,4-triazol-3-yl]diazene?
(Z)-bis[1-(1-adamantyl)-1,2,4-triazol-3-yl]diazene has a molecular weight of 432.58 g/mol, XLogP of 5.14, 4 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-bis[1-(1-adamantyl)-1,2,4-triazol-3-yl]diazene is sourced from PubChem (CID 75538901), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).