C23H27BrN2O — CID 75539231
2-(4-bromophenyl)-5-hexyl-5-methyl-1,10b-dihydropyrazolo[1,5-c][1,3]benzoxazine (PubChem CID 75539231) has the molecular formula C23H27BrN2O and a molecular weight of 427.39 g/mol. Its IUPAC name is 2-(4-bromophenyl)-5-hexyl-5-methyl-1,10b-dihydropyrazolo[1,5-c][1,3]benzoxazine.
| Compound Name | 2-(4-bromophenyl)-5-hexyl-5-methyl-1,10b-dihydropyrazolo[1,5-c][1,3]benzoxazine |
|---|---|
| PubChem CID | 75539231 |
| Molecular Formula | C23H27BrN2O |
| Molecular Weight | 427.39 g/mol |
| Exact Mass | 426.13 |
| IUPAC Name | 2-(4-bromophenyl)-5-hexyl-5-methyl-1,10b-dihydropyrazolo[1,5-c][1,3]benzoxazine |
| SMILES | CCCCCCC1(C)Oc2ccccc2C2CC(c3ccc(Br)cc3)=NN21 |
| InChI | InChI=1S/C23H27BrN2O/c1-3-4-5-8-15-23(2)26-21(19-9-6-7-10-22(19)27-23)16-20(25-26)17-11-13-18(24)14-12-17/h6-7,9-14,21H,3-5,8,15-16H2,1-2H3 |
| InChIKey | ADHFDROAWBZRKA-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.39 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|