About 2-cyclohexyl-N-[(1,1-dioxothiolan-2-yl)methyl]cyclohexan-1-amine
2-cyclohexyl-N-[(1,1-dioxothiolan-2-yl)methyl]cyclohexan-1-amine (PubChem CID 75539689) has the molecular formula C17H31NO2S
and a molecular weight of 313.51 g/mol. Its IUPAC name is 2-cyclohexyl-N-[(1,1-dioxothiolan-2-yl)methyl]cyclohexan-1-amine.
Molecular Properties
| Compound Name | 2-cyclohexyl-N-[(1,1-dioxothiolan-2-yl)methyl]cyclohexan-1-amine |
| PubChem CID | 75539689 |
| Molecular Formula | C17H31NO2S |
| Molecular Weight | 313.51 g/mol |
| Exact Mass | 313.21 |
| IUPAC Name | 2-cyclohexyl-N-[(1,1-dioxothiolan-2-yl)methyl]cyclohexan-1-amine |
| SMILES | O=S1(=O)CCCC1CNC1CCCCC1C1CCCCC1 |
| InChI | InChI=1S/C17H31NO2S/c19-21(20)12-6-9-15(21)13-18-17-11-5-4-10-16(17)14-7-2-1-3-8-14/h14-18H,1-13H2 |
| InChIKey | MFLJIQSYFWOEAF-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.51 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-cyclohexyl-N-[(1,1-dioxothiolan-2-yl)methyl]cyclohexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclohexyl-N-[(1,1-dioxothiolan-2-yl)methyl]cyclohexan-1-amine?
The IUPAC name of 2-cyclohexyl-N-[(1,1-dioxothiolan-2-yl)methyl]cyclohexan-1-amine (CID 75539689) is 2-cyclohexyl-N-[(1,1-dioxothiolan-2-yl)methyl]cyclohexan-1-amine.
What is the SMILES notation for 2-cyclohexyl-N-[(1,1-dioxothiolan-2-yl)methyl]cyclohexan-1-amine?
The canonical SMILES for 2-cyclohexyl-N-[(1,1-dioxothiolan-2-yl)methyl]cyclohexan-1-amine is O=S1(=O)CCCC1CNC1CCCCC1C1CCCCC1.
What is the InChIKey of 2-cyclohexyl-N-[(1,1-dioxothiolan-2-yl)methyl]cyclohexan-1-amine?
The InChIKey is MFLJIQSYFWOEAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H31NO2S/c19-21(20)12-6-9-15(21)13-18-17-11-5-4-10-16(17)14-7-2-1-3-8-14/h14-18H,1-13H2.
What are the key properties of 2-cyclohexyl-N-[(1,1-dioxothiolan-2-yl)methyl]cyclohexan-1-amine?
2-cyclohexyl-N-[(1,1-dioxothiolan-2-yl)methyl]cyclohexan-1-amine has a molecular weight of 313.51 g/mol, XLogP of 3.29, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclohexyl-N-[(1,1-dioxothiolan-2-yl)methyl]cyclohexan-1-amine is sourced from PubChem (CID 75539689), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).