C23H33ClN4O2S — CID 75547299
1-[(2-chlorophenyl)methylsulfanyl]-7-methyl-4-(3-propan-2-yloxypropyl)-3,3a,5a,6,7,8,9,9a-octahydro-[1,2,4]triazolo[4,3-a]quinazolin-5-one (PubChem CID 75547299) has the molecular formula C23H33ClN4O2S and a molecular weight of 465.06 g/mol. Its IUPAC name is 1-[(2-chlorophenyl)methylsulfanyl]-7-methyl-4-(3-propan-2-yloxypropyl)-3,3a,5a,6,7,8,9,9a-octahydro-[1,2,4]triazolo[4,3-a]quinazolin-5-one.
| Compound Name | 1-[(2-chlorophenyl)methylsulfanyl]-7-methyl-4-(3-propan-2-yloxypropyl)-3,3a,5a,6,7,8,9,9a-octahydro-[1,2,4]triazolo[4,3-a]quinazolin-5-one |
|---|---|
| PubChem CID | 75547299 |
| Molecular Formula | C23H33ClN4O2S |
| Molecular Weight | 465.06 g/mol |
| Exact Mass | 464.20 |
| IUPAC Name | 1-[(2-chlorophenyl)methylsulfanyl]-7-methyl-4-(3-propan-2-yloxypropyl)-3,3a,5a,6,7,8,9,9a-octahydro-[1,2,4]triazolo[4,3-a]quinazolin-5-one |
| SMILES | CC1CCC2C(C1)C(=O)N(CCCOC(C)C)C1NN=C(SCc3ccccc3Cl)N21 |
| InChI | InChI=1S/C23H33ClN4O2S/c1-15(2)30-12-6-11-27-21(29)18-13-16(3)9-10-20(18)28-22(27)25-26-23(28)31-14-17-7-4-5-8-19(17)24/h4-5,7-8,15-16,18,20,22,25H,6,9-14H2,1-3H3 |
| InChIKey | GIGWNQDTYBQGOC-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 57.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.06 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|