C14H17N3OS3 — CID 7554748
[2-[2,5-dimethyl-1-(1,3-thiazol-2-yl)pyrrol-3-yl]-2-oxoethyl] N,N-dimethylcarbamodithioate (PubChem CID 7554748) has the molecular formula C14H17N3OS3 and a molecular weight of 339.51 g/mol. Its IUPAC name is [2-[2,5-dimethyl-1-(1,3-thiazol-2-yl)pyrrol-3-yl]-2-oxoethyl] N,N-dimethylcarbamodithioate.
| Compound Name | [2-[2,5-dimethyl-1-(1,3-thiazol-2-yl)pyrrol-3-yl]-2-oxoethyl] N,N-dimethylcarbamodithioate |
|---|---|
| PubChem CID | 7554748 |
| Molecular Formula | C14H17N3OS3 |
| Molecular Weight | 339.51 g/mol |
| Exact Mass | 339.05 |
| IUPAC Name | [2-[2,5-dimethyl-1-(1,3-thiazol-2-yl)pyrrol-3-yl]-2-oxoethyl] N,N-dimethylcarbamodithioate |
| SMILES | Cc1cc(C(=O)CSC(=S)N(C)C)c(C)n1-c1nccs1 |
| InChI | InChI=1S/C14H17N3OS3/c1-9-7-11(12(18)8-21-14(19)16(3)4)10(2)17(9)13-15-5-6-20-13/h5-7H,8H2,1-4H3 |
| InChIKey | XTUZSXHUHYUGML-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.51 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|