C28H40N4O6 — CID 75550119
N-butan-2-yl-2-[6,7-dimethoxy-2,4-dioxo-3-[[4-(pyrrolidine-1-carbonyl)phenyl]methyl]-4a,5,6,7,8,8a-hexahydroquinazolin-1-yl]acetamide (PubChem CID 75550119) has the molecular formula C28H40N4O6 and a molecular weight of 528.65 g/mol. Its IUPAC name is N-butan-2-yl-2-[6,7-dimethoxy-2,4-dioxo-3-[[4-(pyrrolidine-1-carbonyl)phenyl]methyl]-4a,5,6,7,8,8a-hexahydroquinazolin-1-yl]acetamide.
| Compound Name | N-butan-2-yl-2-[6,7-dimethoxy-2,4-dioxo-3-[[4-(pyrrolidine-1-carbonyl)phenyl]methyl]-4a,5,6,7,8,8a-hexahydroquinazolin-1-yl]acetamide |
|---|---|
| PubChem CID | 75550119 |
| Molecular Formula | C28H40N4O6 |
| Molecular Weight | 528.65 g/mol |
| Exact Mass | 528.29 |
| IUPAC Name | N-butan-2-yl-2-[6,7-dimethoxy-2,4-dioxo-3-[[4-(pyrrolidine-1-carbonyl)phenyl]methyl]-4a,5,6,7,8,8a-hexahydroquinazolin-1-yl]acetamide |
| SMILES | CCC(C)NC(=O)CN1C(=O)N(Cc2ccc(C(=O)N3CCCC3)cc2)C(=O)C2CC(OC)C(OC)CC21 |
| InChI | InChI=1S/C28H40N4O6/c1-5-18(2)29-25(33)17-31-22-15-24(38-4)23(37-3)14-21(22)27(35)32(28(31)36)16-19-8-10-20(11-9-19)26(34)30-12-6-7-13-30/h8-11,18,21-24H,5-7,12-17H2,1-4H3,(H,29,33) |
| InChIKey | PDUWFRQWDYBJAB-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 108.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.65 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |