C15H17N3O5 — CID 7555096
[(2S)-1-(carbamoylamino)-1-oxopropan-2-yl] (Z)-2-acetamido-3-phenylprop-2-enoate (PubChem CID 7555096) has the molecular formula C15H17N3O5 and a molecular weight of 319.32 g/mol. Its IUPAC name is [(2S)-1-(carbamoylamino)-1-oxopropan-2-yl] (Z)-2-acetamido-3-phenylprop-2-enoate.
| Compound Name | [(2S)-1-(carbamoylamino)-1-oxopropan-2-yl] (Z)-2-acetamido-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 7555096 |
| Molecular Formula | C15H17N3O5 |
| Molecular Weight | 319.32 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | [(2S)-1-(carbamoylamino)-1-oxopropan-2-yl] (Z)-2-acetamido-3-phenylprop-2-enoate |
| SMILES | CC(=O)N/C(=C\c1ccccc1)C(=O)O[C@@H](C)C(=O)NC(N)=O |
| InChI | InChI=1S/C15H17N3O5/c1-9(13(20)18-15(16)22)23-14(21)12(17-10(2)19)8-11-6-4-3-5-7-11/h3-9H,1-2H3,(H,17,19)(H3,16,18,20,22)/b12-8-/t9-/m0/s1 |
| InChIKey | CTZAQYRRFGWCFC-RILYUOAZSA-N |
| XLogP | 0.29 |
| TPSA | 127.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.32 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|