C10H13F4N3O — CID 755539
5-ethyl-4-methyl-6-(2,2,3,3-tetrafluoropropoxy)pyrimidin-2-amine (PubChem CID 755539) has the molecular formula C10H13F4N3O and a molecular weight of 267.23 g/mol. Its IUPAC name is 5-ethyl-4-methyl-6-(2,2,3,3-tetrafluoropropoxy)pyrimidin-2-amine.
| Compound Name | 5-ethyl-4-methyl-6-(2,2,3,3-tetrafluoropropoxy)pyrimidin-2-amine |
|---|---|
| PubChem CID | 755539 |
| Molecular Formula | C10H13F4N3O |
| Molecular Weight | 267.23 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | 5-ethyl-4-methyl-6-(2,2,3,3-tetrafluoropropoxy)pyrimidin-2-amine |
| SMILES | CCc1c(C)nc(N)nc1OCC(F)(F)C(F)F |
| InChI | InChI=1S/C10H13F4N3O/c1-3-6-5(2)16-9(15)17-7(6)18-4-10(13,14)8(11)12/h8H,3-4H2,1-2H3,(H2,15,16,17) |
| InChIKey | IKCYMCOYETZOGF-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.23 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|