C17H14N5O5- — CID 7556257
(2R)-3-(1H-imidazol-5-yl)-2-[[(5R)-2,4,6-trioxo-1-phenyl-1,3-diazinan-5-yl]methylideneamino]propanoate (PubChem CID 7556257) has the molecular formula C17H14N5O5- and a molecular weight of 368.33 g/mol. Its IUPAC name is (2R)-3-(1H-imidazol-5-yl)-2-[[(5R)-2,4,6-trioxo-1-phenyl-1,3-diazinan-5-yl]methylideneamino]propanoate.
| Compound Name | (2R)-3-(1H-imidazol-5-yl)-2-[[(5R)-2,4,6-trioxo-1-phenyl-1,3-diazinan-5-yl]methylideneamino]propanoate |
|---|---|
| PubChem CID | 7556257 |
| Molecular Formula | C17H14N5O5- |
| Molecular Weight | 368.33 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | (2R)-3-(1H-imidazol-5-yl)-2-[[(5R)-2,4,6-trioxo-1-phenyl-1,3-diazinan-5-yl]methylideneamino]propanoate |
| SMILES | O=C1NC(=O)N(c2ccccc2)C(=O)[C@@H]1/C=N/[C@H](Cc1cnc[nH]1)C(=O)[O-] |
| InChI | InChI=1S/C17H15N5O5/c23-14-12(8-19-13(16(25)26)6-10-7-18-9-20-10)15(24)22(17(27)21-14)11-4-2-1-3-5-11/h1-5,7-9,12-13H,6H2,(H,18,20)(H,25,26)(H,21,23,27)/p-1/b19-8+/t12-,13-/m1/s1 |
| InChIKey | DNZFPHAXMFOVGP-VHCMUOAASA-M |
| XLogP | -0.96 |
| TPSA | 147.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.33 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|