About ethyl 4-(2,6-dimethyl-4-oxo-5-phenylpyrimidin-1-yl)benzoate
ethyl 4-(2,6-dimethyl-4-oxo-5-phenylpyrimidin-1-yl)benzoate (PubChem CID 755634) has the molecular formula C21H20N2O3
and a molecular weight of 348.40 g/mol. Its IUPAC name is ethyl 4-(2,6-dimethyl-4-oxo-5-phenylpyrimidin-1-yl)benzoate.
Molecular Properties
| Compound Name | ethyl 4-(2,6-dimethyl-4-oxo-5-phenylpyrimidin-1-yl)benzoate |
| PubChem CID | 755634 |
| Molecular Formula | C21H20N2O3 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | ethyl 4-(2,6-dimethyl-4-oxo-5-phenylpyrimidin-1-yl)benzoate |
| SMILES | CCOC(=O)c1ccc(-n2c(C)nc(=O)c(-c3ccccc3)c2C)cc1 |
| InChI | InChI=1S/C21H20N2O3/c1-4-26-21(25)17-10-12-18(13-11-17)23-14(2)19(20(24)22-15(23)3)16-8-6-5-7-9-16/h5-13H,4H2,1-3H3 |
| InChIKey | GRXFUSPFPHVRIS-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 4-(2,6-dimethyl-4-oxo-5-phenylpyrimidin-1-yl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-(2,6-dimethyl-4-oxo-5-phenylpyrimidin-1-yl)benzoate?
The IUPAC name of ethyl 4-(2,6-dimethyl-4-oxo-5-phenylpyrimidin-1-yl)benzoate (CID 755634) is ethyl 4-(2,6-dimethyl-4-oxo-5-phenylpyrimidin-1-yl)benzoate.
What is the SMILES notation for ethyl 4-(2,6-dimethyl-4-oxo-5-phenylpyrimidin-1-yl)benzoate?
The canonical SMILES for ethyl 4-(2,6-dimethyl-4-oxo-5-phenylpyrimidin-1-yl)benzoate is CCOC(=O)c1ccc(-n2c(C)nc(=O)c(-c3ccccc3)c2C)cc1.
What is the InChIKey of ethyl 4-(2,6-dimethyl-4-oxo-5-phenylpyrimidin-1-yl)benzoate?
The InChIKey is GRXFUSPFPHVRIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H20N2O3/c1-4-26-21(25)17-10-12-18(13-11-17)23-14(2)19(20(24)22-15(23)3)16-8-6-5-7-9-16/h5-13H,4H2,1-3H3.
What are the key properties of ethyl 4-(2,6-dimethyl-4-oxo-5-phenylpyrimidin-1-yl)benzoate?
ethyl 4-(2,6-dimethyl-4-oxo-5-phenylpyrimidin-1-yl)benzoate has a molecular weight of 348.40 g/mol, XLogP of 3.69, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-(2,6-dimethyl-4-oxo-5-phenylpyrimidin-1-yl)benzoate is sourced from PubChem (CID 755634), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).