About ethyl 5-amino-1-(4-chlorophenyl)-6-oxo-1,2,4-triazine-3-carboxylate
ethyl 5-amino-1-(4-chlorophenyl)-6-oxo-1,2,4-triazine-3-carboxylate (PubChem CID 755676) has the molecular formula C12H11ClN4O3
and a molecular weight of 294.70 g/mol. Its IUPAC name is ethyl 5-amino-1-(4-chlorophenyl)-6-oxo-1,2,4-triazine-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 5-amino-1-(4-chlorophenyl)-6-oxo-1,2,4-triazine-3-carboxylate |
| PubChem CID | 755676 |
| Molecular Formula | C12H11ClN4O3 |
| Molecular Weight | 294.70 g/mol |
| Exact Mass | 294.05 |
| IUPAC Name | ethyl 5-amino-1-(4-chlorophenyl)-6-oxo-1,2,4-triazine-3-carboxylate |
| SMILES | CCOC(=O)c1nc(N)c(=O)n(-c2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C12H11ClN4O3/c1-2-20-12(19)10-15-9(14)11(18)17(16-10)8-5-3-7(13)4-6-8/h3-6H,2H2,1H3,(H2,14,15,16) |
| InChIKey | KQSOFSUOWYUWPJ-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 100.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.70 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze ethyl 5-amino-1-(4-chlorophenyl)-6-oxo-1,2,4-triazine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-amino-1-(4-chlorophenyl)-6-oxo-1,2,4-triazine-3-carboxylate?
The IUPAC name of ethyl 5-amino-1-(4-chlorophenyl)-6-oxo-1,2,4-triazine-3-carboxylate (CID 755676) is ethyl 5-amino-1-(4-chlorophenyl)-6-oxo-1,2,4-triazine-3-carboxylate.
What is the SMILES notation for ethyl 5-amino-1-(4-chlorophenyl)-6-oxo-1,2,4-triazine-3-carboxylate?
The canonical SMILES for ethyl 5-amino-1-(4-chlorophenyl)-6-oxo-1,2,4-triazine-3-carboxylate is CCOC(=O)c1nc(N)c(=O)n(-c2ccc(Cl)cc2)n1.
What is the InChIKey of ethyl 5-amino-1-(4-chlorophenyl)-6-oxo-1,2,4-triazine-3-carboxylate?
The InChIKey is KQSOFSUOWYUWPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11ClN4O3/c1-2-20-12(19)10-15-9(14)11(18)17(16-10)8-5-3-7(13)4-6-8/h3-6H,2H2,1H3,(H2,14,15,16).
What are the key properties of ethyl 5-amino-1-(4-chlorophenyl)-6-oxo-1,2,4-triazine-3-carboxylate?
ethyl 5-amino-1-(4-chlorophenyl)-6-oxo-1,2,4-triazine-3-carboxylate has a molecular weight of 294.70 g/mol, XLogP of 1.04, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-amino-1-(4-chlorophenyl)-6-oxo-1,2,4-triazine-3-carboxylate is sourced from PubChem (CID 755676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).