About 2-phenylethenyl 2-phenylacetate
2-phenylethenyl 2-phenylacetate (PubChem CID 75576890) has the molecular formula C16H14O2
and a molecular weight of 238.29 g/mol. Its IUPAC name is 2-phenylethenyl 2-phenylacetate.
Molecular Properties
| Compound Name | 2-phenylethenyl 2-phenylacetate |
| PubChem CID | 75576890 |
| Molecular Formula | C16H14O2 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | 2-phenylethenyl 2-phenylacetate |
| SMILES | O=C(Cc1ccccc1)OC=Cc1ccccc1 |
| InChI | InChI=1S/C16H14O2/c17-16(13-15-9-5-2-6-10-15)18-12-11-14-7-3-1-4-8-14/h1-12H,13H2 |
| InChIKey | OQIDJPPRRLRDSN-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 2-phenylethenyl 2-phenylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylethenyl 2-phenylacetate?
The IUPAC name of 2-phenylethenyl 2-phenylacetate (CID 75576890) is 2-phenylethenyl 2-phenylacetate.
What is the SMILES notation for 2-phenylethenyl 2-phenylacetate?
The canonical SMILES for 2-phenylethenyl 2-phenylacetate is O=C(Cc1ccccc1)OC=Cc1ccccc1.
What is the InChIKey of 2-phenylethenyl 2-phenylacetate?
The InChIKey is OQIDJPPRRLRDSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14O2/c17-16(13-15-9-5-2-6-10-15)18-12-11-14-7-3-1-4-8-14/h1-12H,13H2.
What are the key properties of 2-phenylethenyl 2-phenylacetate?
2-phenylethenyl 2-phenylacetate has a molecular weight of 238.29 g/mol, XLogP of 3.44, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylethenyl 2-phenylacetate is sourced from PubChem (CID 75576890), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).