C22H16ClFN6O — CID 75578466
8-chloro-2-(3-fluorophenyl)-3-[1-(7H-purin-6-ylamino)ethyl]isoquinolin-1-one (PubChem CID 75578466) has the molecular formula C22H16ClFN6O and a molecular weight of 434.86 g/mol. Its IUPAC name is 8-chloro-2-(3-fluorophenyl)-3-[1-(7H-purin-6-ylamino)ethyl]isoquinolin-1-one.
| Compound Name | 8-chloro-2-(3-fluorophenyl)-3-[1-(7H-purin-6-ylamino)ethyl]isoquinolin-1-one |
|---|---|
| PubChem CID | 75578466 |
| Molecular Formula | C22H16ClFN6O |
| Molecular Weight | 434.86 g/mol |
| Exact Mass | 434.11 |
| IUPAC Name | 8-chloro-2-(3-fluorophenyl)-3-[1-(7H-purin-6-ylamino)ethyl]isoquinolin-1-one |
| SMILES | CC(Nc1ncnc2nc[nH]c12)c1cc2cccc(Cl)c2c(=O)n1-c1cccc(F)c1 |
| InChI | InChI=1S/C22H16ClFN6O/c1-12(29-21-19-20(26-10-25-19)27-11-28-21)17-8-13-4-2-7-16(23)18(13)22(31)30(17)15-6-3-5-14(24)9-15/h2-12H,1H3,(H2,25,26,27,28,29) |
| InChIKey | ORIVRYGKPJSNSQ-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 88.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.86 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |