About 1-methyl-2-methylidene-4,4-bis(phenylmethoxymethyl)cyclopentane-1-carbaldehyde
1-methyl-2-methylidene-4,4-bis(phenylmethoxymethyl)cyclopentane-1-carbaldehyde (PubChem CID 75578750) has the molecular formula C24H28O3
and a molecular weight of 364.48 g/mol. Its IUPAC name is 1-methyl-2-methylidene-4,4-bis(phenylmethoxymethyl)cyclopentane-1-carbaldehyde.
Molecular Properties
| Compound Name | 1-methyl-2-methylidene-4,4-bis(phenylmethoxymethyl)cyclopentane-1-carbaldehyde |
| PubChem CID | 75578750 |
| Molecular Formula | C24H28O3 |
| Molecular Weight | 364.48 g/mol |
| Exact Mass | 364.20 |
| IUPAC Name | 1-methyl-2-methylidene-4,4-bis(phenylmethoxymethyl)cyclopentane-1-carbaldehyde |
| SMILES | C=C1CC(COCc2ccccc2)(COCc2ccccc2)CC1(C)C=O |
| InChI | InChI=1S/C24H28O3/c1-20-13-24(16-23(20,2)17-25,18-26-14-21-9-5-3-6-10-21)19-27-15-22-11-7-4-8-12-22/h3-12,17H,1,13-16,18-19H2,2H3 |
| InChIKey | LTDUZDWDHIGSBV-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.48 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-2-methylidene-4,4-bis(phenylmethoxymethyl)cyclopentane-1-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-2-methylidene-4,4-bis(phenylmethoxymethyl)cyclopentane-1-carbaldehyde?
The IUPAC name of 1-methyl-2-methylidene-4,4-bis(phenylmethoxymethyl)cyclopentane-1-carbaldehyde (CID 75578750) is 1-methyl-2-methylidene-4,4-bis(phenylmethoxymethyl)cyclopentane-1-carbaldehyde.
What is the SMILES notation for 1-methyl-2-methylidene-4,4-bis(phenylmethoxymethyl)cyclopentane-1-carbaldehyde?
The canonical SMILES for 1-methyl-2-methylidene-4,4-bis(phenylmethoxymethyl)cyclopentane-1-carbaldehyde is C=C1CC(COCc2ccccc2)(COCc2ccccc2)CC1(C)C=O.
What is the InChIKey of 1-methyl-2-methylidene-4,4-bis(phenylmethoxymethyl)cyclopentane-1-carbaldehyde?
The InChIKey is LTDUZDWDHIGSBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H28O3/c1-20-13-24(16-23(20,2)17-25,18-26-14-21-9-5-3-6-10-21)19-27-15-22-11-7-4-8-12-22/h3-12,17H,1,13-16,18-19H2,2H3.
What are the key properties of 1-methyl-2-methylidene-4,4-bis(phenylmethoxymethyl)cyclopentane-1-carbaldehyde?
1-methyl-2-methylidene-4,4-bis(phenylmethoxymethyl)cyclopentane-1-carbaldehyde has a molecular weight of 364.48 g/mol, XLogP of 4.96, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-2-methylidene-4,4-bis(phenylmethoxymethyl)cyclopentane-1-carbaldehyde is sourced from PubChem (CID 75578750), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).