C13H25N — CID 75581377
4-methyl-6-propyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizine (PubChem CID 75581377) has the molecular formula C13H25N and a molecular weight of 195.35 g/mol. Its IUPAC name is 4-methyl-6-propyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizine.
| Compound Name | 4-methyl-6-propyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizine |
|---|---|
| PubChem CID | 75581377 |
| Molecular Formula | C13H25N |
| Molecular Weight | 195.35 g/mol |
| Exact Mass | 195.20 |
| IUPAC Name | 4-methyl-6-propyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizine |
| SMILES | CCCC1CCCC2CCCC(C)N12 |
| InChI | InChI=1S/C13H25N/c1-3-6-12-9-5-10-13-8-4-7-11(2)14(12)13/h11-13H,3-10H2,1-2H3 |
| InChIKey | XWIGNCVWEVRDAL-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.35 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |