C11H13ClN2 — CID 75582871
5-chloro-4,11-diazatricyclo[7.3.1.02,7]trideca-2,4,6-triene (PubChem CID 75582871) has the molecular formula C11H13ClN2 and a molecular weight of 208.69 g/mol. Its IUPAC name is 5-chloro-4,11-diazatricyclo[7.3.1.02,7]trideca-2,4,6-triene.
| Compound Name | 5-chloro-4,11-diazatricyclo[7.3.1.02,7]trideca-2,4,6-triene |
|---|---|
| PubChem CID | 75582871 |
| Molecular Formula | C11H13ClN2 |
| Molecular Weight | 208.69 g/mol |
| Exact Mass | 208.08 |
| IUPAC Name | 5-chloro-4,11-diazatricyclo[7.3.1.02,7]trideca-2,4,6-triene |
| SMILES | Clc1cc2c(cn1)C1CNCC(C2)C1 |
| InChI | InChI=1S/C11H13ClN2/c12-11-3-8-1-7-2-9(5-13-4-7)10(8)6-14-11/h3,6-7,9,13H,1-2,4-5H2 |
| InChIKey | JKJZPYHBDCLWAB-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.69 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|