About 11,16-dihydroxyoctadec-9-en-12,14-diynyl acetate
11,16-dihydroxyoctadec-9-en-12,14-diynyl acetate (PubChem CID 75585272) has the molecular formula C20H30O4
and a molecular weight of 334.46 g/mol. Its IUPAC name is 11,16-dihydroxyoctadec-9-en-12,14-diynyl acetate.
Molecular Properties
| Compound Name | 11,16-dihydroxyoctadec-9-en-12,14-diynyl acetate |
| PubChem CID | 75585272 |
| Molecular Formula | C20H30O4 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | 11,16-dihydroxyoctadec-9-en-12,14-diynyl acetate |
| SMILES | CCC(O)C#CC#CC(O)C=CCCCCCCCCOC(C)=O |
| InChI | InChI=1S/C20H30O4/c1-3-19(22)14-11-12-16-20(23)15-10-8-6-4-5-7-9-13-17-24-18(2)21/h10,15,19-20,22-23H,3-9,13,17H2,1-2H3 |
| InChIKey | SBFJUILRJBSVAL-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 11,16-dihydroxyoctadec-9-en-12,14-diynyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 11,16-dihydroxyoctadec-9-en-12,14-diynyl acetate?
The IUPAC name of 11,16-dihydroxyoctadec-9-en-12,14-diynyl acetate (CID 75585272) is 11,16-dihydroxyoctadec-9-en-12,14-diynyl acetate.
What is the SMILES notation for 11,16-dihydroxyoctadec-9-en-12,14-diynyl acetate?
The canonical SMILES for 11,16-dihydroxyoctadec-9-en-12,14-diynyl acetate is CCC(O)C#CC#CC(O)C=CCCCCCCCCOC(C)=O.
What is the InChIKey of 11,16-dihydroxyoctadec-9-en-12,14-diynyl acetate?
The InChIKey is SBFJUILRJBSVAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H30O4/c1-3-19(22)14-11-12-16-20(23)15-10-8-6-4-5-7-9-13-17-24-18(2)21/h10,15,19-20,22-23H,3-9,13,17H2,1-2H3.
What are the key properties of 11,16-dihydroxyoctadec-9-en-12,14-diynyl acetate?
11,16-dihydroxyoctadec-9-en-12,14-diynyl acetate has a molecular weight of 334.46 g/mol, XLogP of 2.97, 11 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 11,16-dihydroxyoctadec-9-en-12,14-diynyl acetate is sourced from PubChem (CID 75585272), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).