C29H34N6O2 — CID 75586502
2-[1-(2-benzyl-1,3-dihydroisoindol-5-yl)piperidin-4-yl]oxy-3-methyl-6-pyrimidin-4-yl-1,3-diazinan-4-one (PubChem CID 75586502) has the molecular formula C29H34N6O2 and a molecular weight of 498.63 g/mol. Its IUPAC name is 2-[1-(2-benzyl-1,3-dihydroisoindol-5-yl)piperidin-4-yl]oxy-3-methyl-6-pyrimidin-4-yl-1,3-diazinan-4-one.
| Compound Name | 2-[1-(2-benzyl-1,3-dihydroisoindol-5-yl)piperidin-4-yl]oxy-3-methyl-6-pyrimidin-4-yl-1,3-diazinan-4-one |
|---|---|
| PubChem CID | 75586502 |
| Molecular Formula | C29H34N6O2 |
| Molecular Weight | 498.63 g/mol |
| Exact Mass | 498.27 |
| IUPAC Name | 2-[1-(2-benzyl-1,3-dihydroisoindol-5-yl)piperidin-4-yl]oxy-3-methyl-6-pyrimidin-4-yl-1,3-diazinan-4-one |
| SMILES | CN1C(=O)CC(c2ccncn2)NC1OC1CCN(c2ccc3c(c2)CN(Cc2ccccc2)C3)CC1 |
| InChI | InChI=1S/C29H34N6O2/c1-33-28(36)16-27(26-9-12-30-20-31-26)32-29(33)37-25-10-13-35(14-11-25)24-8-7-22-18-34(19-23(22)15-24)17-21-5-3-2-4-6-21/h2-9,12,15,20,25,27,29,32H,10-11,13-14,16-19H2,1H3 |
| InChIKey | VDOOAVCADAHFDV-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.63 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|