C18H26N4OS — CID 75588332
2-[propyl(8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-yl)amino]cyclohexan-1-ol (PubChem CID 75588332) has the molecular formula C18H26N4OS and a molecular weight of 346.50 g/mol. Its IUPAC name is 2-[propyl(8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-yl)amino]cyclohexan-1-ol.
| Compound Name | 2-[propyl(8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-yl)amino]cyclohexan-1-ol |
|---|---|
| PubChem CID | 75588332 |
| Molecular Formula | C18H26N4OS |
| Molecular Weight | 346.50 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | 2-[propyl(8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-3-yl)amino]cyclohexan-1-ol |
| SMILES | CCCN(c1ncnc2sc3c(c12)CCNC3)C1CCCCC1O |
| InChI | InChI=1S/C18H26N4OS/c1-2-9-22(13-5-3-4-6-14(13)23)17-16-12-7-8-19-10-15(12)24-18(16)21-11-20-17/h11,13-14,19,23H,2-10H2,1H3 |
| InChIKey | RTAYTPHCAZJVBJ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.50 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |