About methyl 3-imidazo[1,2-a]pyridin-2-ylpropanoate
methyl 3-imidazo[1,2-a]pyridin-2-ylpropanoate (PubChem CID 755885) has the molecular formula C11H12N2O2
and a molecular weight of 204.23 g/mol. Its IUPAC name is methyl 3-imidazo[1,2-a]pyridin-2-ylpropanoate.
Molecular Properties
| Compound Name | methyl 3-imidazo[1,2-a]pyridin-2-ylpropanoate |
| PubChem CID | 755885 |
| Molecular Formula | C11H12N2O2 |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.09 |
| IUPAC Name | methyl 3-imidazo[1,2-a]pyridin-2-ylpropanoate |
| SMILES | COC(=O)CCc1cn2ccccc2n1 |
| InChI | InChI=1S/C11H12N2O2/c1-15-11(14)6-5-9-8-13-7-3-2-4-10(13)12-9/h2-4,7-8H,5-6H2,1H3 |
| InChIKey | DVPSJZJBTMNPLD-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 3-imidazo[1,2-a]pyridin-2-ylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-imidazo[1,2-a]pyridin-2-ylpropanoate?
The IUPAC name of methyl 3-imidazo[1,2-a]pyridin-2-ylpropanoate (CID 755885) is methyl 3-imidazo[1,2-a]pyridin-2-ylpropanoate.
What is the SMILES notation for methyl 3-imidazo[1,2-a]pyridin-2-ylpropanoate?
The canonical SMILES for methyl 3-imidazo[1,2-a]pyridin-2-ylpropanoate is COC(=O)CCc1cn2ccccc2n1.
What is the InChIKey of methyl 3-imidazo[1,2-a]pyridin-2-ylpropanoate?
The InChIKey is DVPSJZJBTMNPLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2O2/c1-15-11(14)6-5-9-8-13-7-3-2-4-10(13)12-9/h2-4,7-8H,5-6H2,1H3.
What are the key properties of methyl 3-imidazo[1,2-a]pyridin-2-ylpropanoate?
methyl 3-imidazo[1,2-a]pyridin-2-ylpropanoate has a molecular weight of 204.23 g/mol, XLogP of 1.44, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-imidazo[1,2-a]pyridin-2-ylpropanoate is sourced from PubChem (CID 755885), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).