About methyl 2-phenylacetate
methyl 2-phenylacetate (PubChem CID 7559) has the molecular formula C9H10O2
and a molecular weight of 150.18 g/mol. Its IUPAC name is methyl 2-phenylacetate.
Molecular Properties
| Compound Name | methyl 2-phenylacetate |
| PubChem CID | 7559 |
| Molecular Formula | C9H10O2 |
| Molecular Weight | 150.18 g/mol |
| Exact Mass | 150.07 |
| IUPAC Name | methyl 2-phenylacetate |
| SMILES | COC(=O)Cc1ccccc1 |
| InChI | InChI=1S/C9H10O2/c1-11-9(10)7-8-5-3-2-4-6-8/h2-6H,7H2,1H3 |
| InChIKey | CRZQGDNQQAALAY-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.18 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze methyl 2-phenylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-phenylacetate?
The IUPAC name of methyl 2-phenylacetate (CID 7559) is methyl 2-phenylacetate.
What is the SMILES notation for methyl 2-phenylacetate?
The canonical SMILES for methyl 2-phenylacetate is COC(=O)Cc1ccccc1.
What is the InChIKey of methyl 2-phenylacetate?
The InChIKey is CRZQGDNQQAALAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O2/c1-11-9(10)7-8-5-3-2-4-6-8/h2-6H,7H2,1H3.
What are the key properties of methyl 2-phenylacetate?
methyl 2-phenylacetate has a molecular weight of 150.18 g/mol, XLogP of 1.40, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-phenylacetate is sourced from PubChem (CID 7559), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).