C15H16N2O2S — CID 755923
(5S)-5-[2-oxo-2-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]-2-sulfanylideneimidazolidin-4-one (PubChem CID 755923) has the molecular formula C15H16N2O2S and a molecular weight of 288.37 g/mol. Its IUPAC name is (5S)-5-[2-oxo-2-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5S)-5-[2-oxo-2-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 755923 |
| Molecular Formula | C15H16N2O2S |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | (5S)-5-[2-oxo-2-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]-2-sulfanylideneimidazolidin-4-one |
| SMILES | O=C(C[C@@H]1NC(=S)NC1=O)c1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C15H16N2O2S/c18-13(8-12-14(19)17-15(20)16-12)11-6-5-9-3-1-2-4-10(9)7-11/h5-7,12H,1-4,8H2,(H2,16,17,19,20)/t12-/m0/s1 |
| InChIKey | XFAAYBQMBLQWKN-LBPRGKRZSA-N |
| XLogP | 1.51 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|