C19H28N4O2 — CID 75592404
N'-(2,3,3a,4,5,6,7,7a-octahydro-1H-indazol-3-ylmethyl)-N'-methyl-N-(4-methylphenyl)propanediamide (PubChem CID 75592404) has the molecular formula C19H28N4O2 and a molecular weight of 344.46 g/mol. Its IUPAC name is N'-(2,3,3a,4,5,6,7,7a-octahydro-1H-indazol-3-ylmethyl)-N'-methyl-N-(4-methylphenyl)propanediamide.
| Compound Name | N'-(2,3,3a,4,5,6,7,7a-octahydro-1H-indazol-3-ylmethyl)-N'-methyl-N-(4-methylphenyl)propanediamide |
|---|---|
| PubChem CID | 75592404 |
| Molecular Formula | C19H28N4O2 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.22 |
| IUPAC Name | N'-(2,3,3a,4,5,6,7,7a-octahydro-1H-indazol-3-ylmethyl)-N'-methyl-N-(4-methylphenyl)propanediamide |
| SMILES | Cc1ccc(NC(=O)CC(=O)N(C)CC2NNC3CCCCC32)cc1 |
| InChI | InChI=1S/C19H28N4O2/c1-13-7-9-14(10-8-13)20-18(24)11-19(25)23(2)12-17-15-5-3-4-6-16(15)21-22-17/h7-10,15-17,21-22H,3-6,11-12H2,1-2H3,(H,20,24) |
| InChIKey | YRFAADNABVZPAK-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|